![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 6206-metabolite-lecture.pdf | 12-Sep-2006 16:49 | 1.4M | |
| 6206-metabolite-lecture.ppt | 12-Sep-2006 15:53 | 2.6M | |
| AAcids2003a.pdf | 07-Dec-2004 14:30 | 184K | |
| AAcids2003b.pdf | 02-Nov-2004 14:38 | 1.2M | |
| AAcids2003c.pdf | 27-Oct-2004 17:16 | 2.3M | |
| AAcids2005.pdf | 18-Nov-2005 12:01 | 1.3M | |
| ATPsynthase.PDF | 10-Oct-2003 12:52 | 759K | |
| BCH6206-2011.pdf | 02-Sep-2011 11:15 | 26K | |
| BCH6206-Exam2-2006.pdf | 02-Aug-2007 11:49 | 145K | |
| BCH6206-Exam2-2007.pdf | 08-Nov-2007 08:26 | 157K | |
| BCH6206 Final Exam-2006.pdf | 07-Aug-2007 14:50 | 26K | |
| BCH6206L.htm | 08-Aug-2006 14:26 | 32K | |
| BCH6206L.php | 30-Apr-2002 16:36 | 2.9K | |
| BCH6206L.txt | 11-Jun-2001 00:00 | 2.2K | |
| BCH6206S.htm | 08-Aug-2006 15:03 | 8.1K | |
| BCH6206S.php | 30-Apr-2002 16:36 | 5.6K | |
| BCH6206entry.php | 11-Feb-2002 09:34 | 4.4K | |
| BCH6206exam1-2006.pdf | 02-Aug-2007 11:46 | 124K | |
| BCH6206exam1-2007.pdf | 08-Nov-2007 08:37 | 292K | |
| BCH6207L.htm | 08-Aug-2006 13:55 | 14K | |
| BCH6207S.htm | 08-Aug-2006 14:55 | 7.8K | |
| BCH6208L.htm | 08-Aug-2006 14:06 | 13K | |
| BCH6208S.htm | 08-Aug-2006 14:56 | 7.1K | |
| BCH6209L.htm | 08-Aug-2006 14:23 | 14K | |
| BCH6209S.htm | 08-Aug-2006 14:57 | 6.9K | |
| Cain-F1F0Lect06.ppt | 19-Oct-2006 11:19 | 20M | |
| Cain.pdf | 12-Oct-2007 11:02 | 33M | |
| Cholesterol-2007.pdf | 24-Oct-2007 09:33 | 539K | |
| DETERGENTS.pdf | 27-Aug-2003 11:44 | 77K | |
| ElectronTransport&OxPhos.pdf | 07-Oct-2004 14:41 | 760K | |
| FAS-ref.pdf | 16-Oct-2003 10:14 | 82K | |
| FASynthesis.pdf | 21-Oct-2003 10:41 | 295K | |
| Fattt Acid Oxidation-2007.pdf | 05-Oct-2007 14:09 | 252K | |
| Fatty Acid Synthesis-2007.pdf | 05-Oct-2007 14:11 | 647K | |
| Gluconeo-ref.pdf | 01-Oct-2003 13:31 | 79K | |
| Gluconeogenesis-2007.pdf | 24-Sep-2007 15:57 | 1.0M | |
| Gluconeogenesis.pdf | 01-Oct-2003 13:14 | 566K | |
| Glycogen-2007.pdf | 24-Sep-2007 13:39 | 1.5M | |
| Glycogen.pdf | 10-Oct-2006 12:38 | 758K | |
| Glycolysis-2007.pdf | 21-Sep-2007 15:11 | 383K | |
| Glycolysis.pdf | 01-Oct-2003 09:47 | 217K | |
| HMP-ref.pdf | 28-Sep-2003 15:13 | 58K | |
| HMP and PDH-2005.pdf | 03-Oct-2005 08:24 | 63K | |
| HMP and PDH-2007.pdf | 21-Sep-2007 15:20 | 351K | |
| Interpretation-2007.pdf | 14-Aug-2007 14:02 | 166K | |
| Interpretation.pdf | 19-Aug-2003 12:10 | 224K | |
| Kilberg-2007-BCH6206.pdf | 10-Sep-2007 10:54 | 1.5M | |
| Kilberg-lecture-handout.pdf | 10-Sep-2007 10:54 | 1.5M | |
| LECTURE1.pdf | 13-Aug-2007 11:03 | 319K | |
| LECTURE2.pdf | 14-Aug-2007 14:02 | 166K | |
| LECTURE3.pdf | 22-Aug-2007 10:05 | 1.1M | |
| LECTURE9.pdf | 27-Aug-2007 13:45 | 835K | |
| Lecture4.pdf | 22-Aug-2007 09:50 | 1.1M | |
| Lecture5.pdf | 22-Aug-2007 11:12 | 767K | |
| Lecture10.pdf | 04-Sep-2007 09:31 | 578K | |
| Lecture11.pdf | 20-Sep-2006 07:43 | 371K | |
| Lecture12.pdf | 20-Aug-2007 16:33 | 650K | |
| Lecture14.pdf | 04-Sep-2007 15:02 | 112K | |
| Lecture15.pdf | 21-Sep-2007 15:11 | 383K | |
| Lecture16.pdf | 21-Sep-2007 15:20 | 351K | |
| Lecture17.pdf | 24-Sep-2007 15:57 | 1.0M | |
| Lecture18&19.pdf | 24-Sep-2007 13:39 | 1.5M | |
| Lecture23.pdf | 05-Oct-2007 14:11 | 647K | |
| Lecture24.pdf | 05-Oct-2007 14:09 | 252K | |
| Lecture25.pdf | 24-Oct-2007 09:33 | 539K | |
| Lecture26.pdf | 16-Oct-2007 10:32 | 1.4M | |
| Lecture27.pdf | 15-Oct-2007 15:00 | 253K | |
| Lipoproteins-2007.pdf | 16-Oct-2007 10:32 | 1.4M | |
| Lipoproteins.pdf | 15-Oct-2003 08:24 | 474K | |
| Membrane1-2007.pdf | 22-Aug-2007 10:05 | 1.1M | |
| Membrane1.pdf | 21-Aug-2003 09:32 | 420K | |
| Membrane2-2007.pdf | 22-Aug-2007 09:50 | 1.1M | |
| Membrane2.pdf | 29-Aug-2006 16:59 | 468K | |
| Metabcon-2007.pdf | 13-Aug-2007 11:03 | 319K | |
| Metabcon.pdf | 22-Aug-2006 13:05 | 111K | |
| Methods1-ref.pdf | 19-Aug-2003 12:57 | 80K | |
| Nucleotide.pdf | 27-Oct-2004 17:05 | 2.2M | |
| OBrien3&4.pdf | 07-Oct-2004 14:41 | 760K | |
| Obrien1.pdf | 30-Aug-2004 10:25 | 5.1M | |
| Obrien2.pdf | 31-Aug-2004 11:35 | 10M | |
| Oxidation-ref.pdf | 16-Oct-2003 11:19 | 74K | |
| Oxidation.pdf | 13-Oct-2006 10:32 | 145K | |
| PDH-ref.pdf | 28-Sep-2003 15:08 | 86K | |
| PFTE043.TMP | 01-Sep-1999 15:27 | 9.3K | |
| Phospholipids and Prostaglandins-2007.pdf | 15-Oct-2007 15:00 | 253K | |
| Phospholipids and prostraglandins.PDF | 01-Dec-2005 09:31 | 246K | |
| Pip.pdf | 22-Aug-2003 15:50 | 42K | |
| SH2-domain.pdf | 22-Aug-2003 10:25 | 58K | |
| Signal1-2007.pdf | 27-Aug-2007 13:45 | 835K | |
| Signal1.pdf | 20-Aug-2003 15:14 | 499K | |
| Signal2-2006.pdf | 12-Sep-2006 15:38 | 332K | |
| Signal2-2007.pdf | 04-Sep-2007 09:31 | 578K | |
| Signal3.pdf | 20-Sep-2006 07:43 | 371K | |
| SignalingIV-lipid rafts.pdf | 21-Sep-2006 16:14 | 418K | |
| SignalingIV-lipid rafts2007.pdf | 20-Aug-2007 16:33 | 650K | |
| Signaling V proteolysis-2007.pdf | 04-Sep-2007 15:02 | 112K | |
| Signaling V proteolysis.pdf | 19-Sep-2003 09:31 | 132K | |
| Stevens.pdf | 07-Sep-2005 10:29 | 1.7M | |
| TCACycle.pdf | 07-Oct-2004 15:05 | 816K | |
| TRANSGEN.PDF | 08-Sep-1998 16:25 | 387K | |
| Transport1-2007.pdf | 22-Aug-2007 11:12 | 767K | |
| Transport1.pdf | 21-Aug-2003 08:49 | 162K | |
| WS_FTP.LOG | 28-Jan-2003 15:20 | 1.3K | |
| WebShow.swf | 29-Aug-2002 15:13 | 160K | |
| cholesterol-ref.pdf | 16-Oct-2007 13:34 | 14K | |
| cholesterol.pdf | 15-Oct-2003 08:05 | 254K | |
| finalexam2002bb.doc | 13-Dec-2002 08:37 | 389K | |
| glycogen-ref-2007.pdf | 24-Sep-2007 16:06 | 16K | |
| glycogen-ref.pdf | 24-Sep-2007 16:06 | 16K | |
| glycolysis-ref.pdf | 16-Oct-2003 11:57 | 68K | |
| halobacterium-slide-fig2.pdf | 27-Aug-2003 16:34 | 109K | |
| interpretation.ref.pdf | 26-Aug-2003 13:50 | 63K | |
| lipidmod2003b.pdf | 20-Oct-2004 16:12 | 2.0M | |
| lipidmod2007.pdf | 25-Oct-2007 12:11 | 623K | |
| lipoprotein-ref.pdf | 16-Oct-2003 11:34 | 47K | |
| membranes-ref.pdf | 19-Aug-2003 13:26 | 88K | |
| phospholipid-prostaglandin-ref.pdf | 15-Oct-2007 15:11 | 15K | |
| signalV.REF.pdf | 22-Aug-2003 13:58 | 75K | |
| signaling1-ref.pdf | 27-Aug-2007 13:53 | 71K | |
| signaling2-ref.pdf | 01-Sep-2004 13:46 | 79K | |
| signaling3-ref.pdf | 22-Aug-2003 11:44 | 77K | |
| transport-ref.pdf | 22-Aug-2007 11:06 | 66K | |
| transport1-ref.pdf | 20-Aug-2003 11:12 | 71K | |
| webshow.html | 11-Aug-2000 15:46 | 711 | |